C29H37F3N2O4 — CID 124773574
N-[(3S)-1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3-(4-methoxyphenyl)propanamide (PubChem CID 124773574) has the molecular formula C29H37F3N2O4 and a molecular weight of 534.62 g/mol. Its IUPAC name is N-[(3S)-1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[(3S)-1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 124773574 |
| Molecular Formula | C29H37F3N2O4 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | N-[(3S)-1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)N[C@]2(C(F)(F)F)C(=O)N([C@@H]3CCC[C@H](C)[C@H]3C)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C29H37F3N2O4/c1-17-7-6-8-21(18(17)2)34-22-15-27(3,4)16-23(35)25(22)28(26(34)37,29(30,31)32)33-24(36)14-11-19-9-12-20(38-5)13-10-19/h9-10,12-13,17-18,21H,6-8,11,14-16H2,1-5H3,(H,33,36)/t17-,18+,21+,28-/m0/s1 |
| InChIKey | IWLZYVMXMDAYFU-IXWSHXFHSA-N |
| XLogP | 5.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |