C26H33F3N2O5 — CID 2217179
N-[(3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-2,2-dimethylpropanamide (PubChem CID 2217179) has the molecular formula C26H33F3N2O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is N-[(3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2217179 |
| Molecular Formula | C26H33F3N2O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[(3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(CCN2C(=O)[C@@](NC(=O)C(C)(C)C)(C(F)(F)F)C3=C2CC(C)(C)CC3=O)cc1OC |
| InChI | InChI=1S/C26H33F3N2O5/c1-23(2,3)21(33)30-25(26(27,28)29)20-16(13-24(4,5)14-17(20)32)31(22(25)34)11-10-15-8-9-18(35-6)19(12-15)36-7/h8-9,12H,10-11,13-14H2,1-7H3,(H,30,33)/t25-/m1/s1 |
| InChIKey | JMIISYUBDOEMLT-RUZDIDTESA-N |
| XLogP | 4.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |