C22H25F3N4O6 — CID 2962323
N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2,2-dimethylpropanamide (PubChem CID 2962323) has the molecular formula C22H25F3N4O6 and a molecular weight of 498.46 g/mol. Its IUPAC name is N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2962323 |
| Molecular Formula | C22H25F3N4O6 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,4,6-trioxo-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(CCn2c3c(c(=O)[nH]c2=O)C(NC(=O)C(C)(C)C)(C(F)(F)F)C(=O)N3)cc1OC |
| InChI | InChI=1S/C22H25F3N4O6/c1-20(2,3)17(31)28-21(22(23,24)25)14-15(26-18(21)32)29(19(33)27-16(14)30)9-8-11-6-7-12(34-4)13(10-11)35-5/h6-7,10H,8-9H2,1-5H3,(H,26,32)(H,28,31)(H,27,30,33) |
| InChIKey | DEDOBTBTAFYHMF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |