C29H31F3N2O7 — CID 4917329
N-[1-[(2,3-dimethoxyphenyl)methyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3,4-dimethoxybenzamide (PubChem CID 4917329) has the molecular formula C29H31F3N2O7 and a molecular weight of 576.57 g/mol. Its IUPAC name is N-[1-[(2,3-dimethoxyphenyl)methyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-[(2,3-dimethoxyphenyl)methyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4917329 |
| Molecular Formula | C29H31F3N2O7 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | N-[1-[(2,3-dimethoxyphenyl)methyl]-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-5,7-dihydroindol-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2(C(F)(F)F)C(=O)N(Cc3cccc(OC)c3OC)C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C29H31F3N2O7/c1-27(2)13-18-23(19(35)14-27)28(29(30,31)32,33-25(36)16-10-11-20(38-3)22(12-16)40-5)26(37)34(18)15-17-8-7-9-21(39-4)24(17)41-6/h7-12H,13-15H2,1-6H3,(H,33,36) |
| InChIKey | UMCDNDOGPXUODZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |