C15H18N4O2 — CID 124774607
(1S,6S,7R,8R,10R)-8-butyl-5-imino-1,10-dimethyl-2,9-dioxa-4-azatricyclo[4.3.1.03,7]dec-3-ene-6,7-dicarbonitrile (PubChem CID 124774607) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is (1S,6S,7R,8R,10R)-8-butyl-5-imino-1,10-dimethyl-2,9-dioxa-4-azatricyclo[4.3.1.03,7]dec-3-ene-6,7-dicarbonitrile.
| Compound Name | (1S,6S,7R,8R,10R)-8-butyl-5-imino-1,10-dimethyl-2,9-dioxa-4-azatricyclo[4.3.1.03,7]dec-3-ene-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 124774607 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1S,6S,7R,8R,10R)-8-butyl-5-imino-1,10-dimethyl-2,9-dioxa-4-azatricyclo[4.3.1.03,7]dec-3-ene-6,7-dicarbonitrile |
| SMILES | [H]/N=C1\N=C2O[C@]3(C)O[C@H](CCCC)[C@]2(C#N)[C@]1(C#N)[C@H]3C |
| InChI | InChI=1S/C15H18N4O2/c1-4-5-6-10-15(8-17)12-19-11(18)14(15,7-16)9(2)13(3,20-10)21-12/h9-10,18H,4-6H2,1-3H3/b18-11-/t9-,10+,13-,14+,15-/m0/s1 |
| InChIKey | IPNIKLODWZFANW-ZJFQSRKRSA-N |
| XLogP | 2.37 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|