C34H26N2O4 — CID 124774922
(1R,2R,6S,7R)-4-[3-[(E)-4-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]but-1-en-3-ynyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 124774922) has the molecular formula C34H26N2O4 and a molecular weight of 526.59 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[3-[(E)-4-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]but-1-en-3-ynyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[3-[(E)-4-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]but-1-en-3-ynyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124774922 |
| Molecular Formula | C34H26N2O4 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | (1R,2R,6S,7R)-4-[3-[(E)-4-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]but-1-en-3-ynyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1cccc(/C=C/C#Cc3cccc(N4C(=O)[C@H]5[C@H](C4=O)[C@H]4C=C[C@H]5C4)c3)c1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C34H26N2O4/c37-31-27-21-11-12-22(17-21)28(27)32(38)35(31)25-9-3-7-19(15-25)5-1-2-6-20-8-4-10-26(16-20)36-33(39)29-23-13-14-24(18-23)30(29)34(36)40/h1,3-5,7-16,21-24,27-30H,17-18H2/b5-1+/t21-,22-,23-,24-,27-,28+,29+,30+/m0/s1 |
| InChIKey | QVGAILSNJAAGKK-WHPZHKIBSA-N |
| XLogP | 4.37 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|