C18H20N4O2 — CID 124775222
(1R,6S,8S,12S)-9-imino-12-[(E)-pent-2-en-2-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile (PubChem CID 124775222) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (1R,6S,8S,12S)-9-imino-12-[(E)-pent-2-en-2-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile.
| Compound Name | (1R,6S,8S,12S)-9-imino-12-[(E)-pent-2-en-2-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
|---|---|
| PubChem CID | 124775222 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (1R,6S,8S,12S)-9-imino-12-[(E)-pent-2-en-2-yl]-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@]23CCCC[C@H]2C(C#N)(C#N)[C@]1(C#N)[C@H](/C(C)=C/CC)O3 |
| InChI | InChI=1S/C18H20N4O2/c1-3-6-12(2)14-17(11-21)15(22)24-18(23-14)8-5-4-7-13(18)16(17,9-19)10-20/h6,13-14,22H,3-5,7-8H2,1-2H3/b12-6+,22-15-/t13-,14-,17+,18+/m0/s1 |
| InChIKey | ZGELXJGFVSYQGG-WZULKNRHSA-N |
| XLogP | 3.18 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|