C21H22FN3O3S — CID 124775497
(1R,9S,13R)-10-(4-fluorophenyl)-6-methoxy-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 124775497) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is (1R,9S,13R)-10-(4-fluorophenyl)-6-methoxy-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13R)-10-(4-fluorophenyl)-6-methoxy-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 124775497 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (1R,9S,13R)-10-(4-fluorophenyl)-6-methoxy-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COc1cccc2c1O[C@@]1(C)[C@H](C(=O)N(C)C)[C@H]2NC(=S)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN3O3S/c1-21-16(19(26)24(2)3)17(14-6-5-7-15(27-4)18(14)28-21)23-20(29)25(21)13-10-8-12(22)9-11-13/h5-11,16-17H,1-4H3,(H,23,29)/t16-,17-,21-/m0/s1 |
| InChIKey | JYNVJKCDJLLFPH-FIKGOQFSSA-N |
| XLogP | 3.08 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|