C21H20ClNO2 — CID 124776218
(1S,2R,10S,11R,12S)-10-(3-chlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylic acid (PubChem CID 124776218) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is (1S,2R,10S,11R,12S)-10-(3-chlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylic acid.
| Compound Name | (1S,2R,10S,11R,12S)-10-(3-chlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 124776218 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (1S,2R,10S,11R,12S)-10-(3-chlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@@H](c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C21H20ClNO2/c22-15-3-1-2-13(9-15)20-19-12-5-4-11(8-12)18(19)16-10-14(21(24)25)6-7-17(16)23-20/h1-3,6-7,9-12,18-20,23H,4-5,8H2,(H,24,25)/t11-,12-,18-,19+,20+/m0/s1 |
| InChIKey | JSDSWYFAEKEBDJ-CQTZQYROSA-N |
| XLogP | 5.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |