C24H26N2O — CID 124786976
(1S,2R,10R,11R,12S)-N-cyclopropyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 124786976) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-cyclopropyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-cyclopropyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 124786976 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-cyclopropyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C24H26N2O/c27-24(25-18-9-10-18)17-8-11-20-19(13-17)21-15-6-7-16(12-15)22(21)23(26-20)14-4-2-1-3-5-14/h1-5,8,11,13,15-16,18,21-23,26H,6-7,9-10,12H2,(H,25,27)/t15-,16-,21-,22+,23-/m0/s1 |
| InChIKey | ZTRBOBVGGNZMJG-WTBHFOSASA-N |
| XLogP | 4.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |