C27H32N2O — CID 126150665
(1S,2R,10R,11R,12S)-N-cyclohexyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126150665) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-cyclohexyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-cyclohexyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126150665 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-cyclohexyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C27H32N2O/c30-27(28-21-9-5-2-6-10-21)20-13-14-23-22(16-20)24-18-11-12-19(15-18)25(24)26(29-23)17-7-3-1-4-8-17/h1,3-4,7-8,13-14,16,18-19,21,24-26,29H,2,5-6,9-12,15H2,(H,28,30)/t18-,19-,24-,25+,26-/m0/s1 |
| InChIKey | OPPVOIOXBNIHGH-YVQVFXEXSA-N |
| XLogP | 6.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |