C27H32N2O — CID 126176013
azepan-1-yl-[(1S,2R,10S,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone (PubChem CID 126176013) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is azepan-1-yl-[(1S,2R,10S,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone.
| Compound Name | azepan-1-yl-[(1S,2R,10S,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone |
|---|---|
| PubChem CID | 126176013 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | azepan-1-yl-[(1S,2R,10S,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]1[C@@H](c1ccccc1)N2)N1CCCCCC1 |
| InChI | InChI=1S/C27H32N2O/c30-27(29-14-6-1-2-7-15-29)21-12-13-23-22(17-21)24-19-10-11-20(16-19)25(24)26(28-23)18-8-4-3-5-9-18/h3-5,8-9,12-13,17,19-20,24-26,28H,1-2,6-7,10-11,14-16H2/t19-,20-,24-,25-,26+/m0/s1 |
| InChIKey | YXZSLCXYFHAABE-WQLLKYAWSA-N |
| XLogP | 6.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |