C28H34N2O — CID 126180716
(1S,2R,10R,11S,12S)-N-cycloheptyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126180716) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is (1S,2R,10R,11S,12S)-N-cycloheptyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11S,12S)-N-cycloheptyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126180716 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (1S,2R,10R,11S,12S)-N-cycloheptyl-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C28H34N2O/c31-28(29-22-10-6-1-2-7-11-22)21-14-15-24-23(17-21)25-19-12-13-20(16-19)26(25)27(30-24)18-8-4-3-5-9-18/h3-5,8-9,14-15,17,19-20,22,25-27,30H,1-2,6-7,10-13,16H2,(H,29,31)/t19-,20-,25-,26-,27-/m0/s1 |
| InChIKey | UBJZZVDRJMYYSK-OYRJNNPGSA-N |
| XLogP | 6.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |