C29H30N2O — CID 126143130
(1S,2R,10S,11S,12S)-10-phenyl-N-(2-phenylethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126143130) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is (1S,2R,10S,11S,12S)-10-phenyl-N-(2-phenylethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10S,11S,12S)-10-phenyl-N-(2-phenylethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126143130 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (1S,2R,10S,11S,12S)-10-phenyl-N-(2-phenylethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]1[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C29H30N2O/c32-29(30-16-15-19-7-3-1-4-8-19)23-13-14-25-24(18-23)26-21-11-12-22(17-21)27(26)28(31-25)20-9-5-2-6-10-20/h1-10,13-14,18,21-22,26-28,31H,11-12,15-17H2,(H,30,32)/t21-,22-,26-,27-,28+/m0/s1 |
| InChIKey | VWGDBASJKRRHRG-WTBBXUJBSA-N |
| XLogP | 5.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |