C25H30N2O2 — CID 6598579
(1S,2S,10R,11S,12S)-N-(3-methoxypropyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 6598579) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (1S,2S,10R,11S,12S)-N-(3-methoxypropyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2S,10R,11S,12S)-N-(3-methoxypropyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 6598579 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (1S,2S,10R,11S,12S)-N-(3-methoxypropyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | COCCCNC(=O)c1ccc2c(c1)[C@H]1[C@H]3CC[C@@H](C3)[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C25H30N2O2/c1-29-13-5-12-26-25(28)19-10-11-21-20(15-19)22-17-8-9-18(14-17)23(22)24(27-21)16-6-3-2-4-7-16/h2-4,6-7,10-11,15,17-18,22-24,27H,5,8-9,12-14H2,1H3,(H,26,28)/t17-,18-,22+,23-,24-/m0/s1 |
| InChIKey | PTUWZIHJUNFZQP-LWMMKVNCSA-N |
| XLogP | 4.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|