C28H27ClN2O — CID 126179209
(1S,2R,10R,11S,12S)-N-[(2-chlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126179209) has the molecular formula C28H27ClN2O and a molecular weight of 442.99 g/mol. Its IUPAC name is (1S,2R,10R,11S,12S)-N-[(2-chlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11S,12S)-N-[(2-chlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126179209 |
| Molecular Formula | C28H27ClN2O |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (1S,2R,10R,11S,12S)-N-[(2-chlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C28H27ClN2O/c29-23-9-5-4-8-21(23)16-30-28(32)20-12-13-24-22(15-20)25-18-10-11-19(14-18)26(25)27(31-24)17-6-2-1-3-7-17/h1-9,12-13,15,18-19,25-27,31H,10-11,14,16H2,(H,30,32)/t18-,19-,25-,26-,27-/m0/s1 |
| InChIKey | MXPKOQYPZFPWLO-HNNVXOBOSA-N |
| XLogP | 6.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |