C30H31ClN2OS — CID 126172232
(1S,2R,10R,11S,12S)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126172232) has the molecular formula C30H31ClN2OS and a molecular weight of 503.11 g/mol. Its IUPAC name is (1S,2R,10R,11S,12S)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11S,12S)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126172232 |
| Molecular Formula | C30H31ClN2OS |
| Molecular Weight | 503.11 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (1S,2R,10R,11S,12S)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1Cl)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C30H31ClN2OS/c31-25-9-5-4-8-23(25)18-35-15-14-32-30(34)22-12-13-26-24(17-22)27-20-10-11-21(16-20)28(27)29(33-26)19-6-2-1-3-7-19/h1-9,12-13,17,20-21,27-29,33H,10-11,14-16,18H2,(H,32,34)/t20-,21-,27-,28-,29-/m0/s1 |
| InChIKey | BJYQZIPIYITHNA-BSQODDMMSA-N |
| XLogP | 7.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.11 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|