C28H26Cl2N2O — CID 126186142
(1S,2R,10R,11R,12S)-N-[(2,4-dichlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126186142) has the molecular formula C28H26Cl2N2O and a molecular weight of 477.44 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-[(2,4-dichlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-[(2,4-dichlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126186142 |
| Molecular Formula | C28H26Cl2N2O |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-[(2,4-dichlorophenyl)methyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C28H26Cl2N2O/c29-21-10-8-20(23(30)14-21)15-31-28(33)19-9-11-24-22(13-19)25-17-6-7-18(12-17)26(25)27(32-24)16-4-2-1-3-5-16/h1-5,8-11,13-14,17-18,25-27,32H,6-7,12,15H2,(H,31,33)/t17-,18-,25-,26+,27-/m0/s1 |
| InChIKey | OVZVEMFQYZINKZ-STOJIQEYSA-N |
| XLogP | 7.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |