C29H28N2O3 — CID 124724496
(1S,2R,10R,11R,12S)-N-(1,3-benzodioxol-5-ylmethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 124724496) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-(1,3-benzodioxol-5-ylmethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-(1,3-benzodioxol-5-ylmethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 124724496 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-(1,3-benzodioxol-5-ylmethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C29H28N2O3/c32-29(30-15-17-6-11-24-25(12-17)34-16-33-24)21-9-10-23-22(14-21)26-19-7-8-20(13-19)27(26)28(31-23)18-4-2-1-3-5-18/h1-6,9-12,14,19-20,26-28,31H,7-8,13,15-16H2,(H,30,32)/t19-,20-,26-,27+,28-/m0/s1 |
| InChIKey | ZGXAJTSWRODLIW-OTSSDEFXSA-N |
| XLogP | 5.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |