C30H32N2OS — CID 126187061
(1S,2R,10R,11R,12S)-N-(2-benzylsulfanylethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126187061) has the molecular formula C30H32N2OS and a molecular weight of 468.67 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-(2-benzylsulfanylethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-(2-benzylsulfanylethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126187061 |
| Molecular Formula | C30H32N2OS |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-(2-benzylsulfanylethyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C30H32N2OS/c33-30(31-15-16-34-19-20-7-3-1-4-8-20)24-13-14-26-25(18-24)27-22-11-12-23(17-22)28(27)29(32-26)21-9-5-2-6-10-21/h1-10,13-14,18,22-23,27-29,32H,11-12,15-17,19H2,(H,31,33)/t22-,23-,27-,28+,29-/m0/s1 |
| InChIKey | VSDXNTRLZUVVEJ-NSNMTAISSA-N |
| XLogP | 6.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|