C31H34N2OS — CID 126186538
(1S,2R,10R,11R,12S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126186538) has the molecular formula C31H34N2OS and a molecular weight of 482.69 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126186538 |
| Molecular Formula | C31H34N2OS |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | Cc1ccccc1CSCCNC(=O)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C31H34N2OS/c1-20-7-5-6-10-25(20)19-35-16-15-32-31(34)24-13-14-27-26(18-24)28-22-11-12-23(17-22)29(28)30(33-27)21-8-3-2-4-9-21/h2-10,13-14,18,22-23,28-30,33H,11-12,15-17,19H2,1H3,(H,32,34)/t22-,23-,28-,29+,30-/m0/s1 |
| InChIKey | QNBFLOIVRGDTOX-TVHGEUBISA-N |
| XLogP | 6.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|