C33H35N3O3 — CID 126185106
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(1S,2R,10R,11R,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone (PubChem CID 126185106) has the molecular formula C33H35N3O3 and a molecular weight of 521.66 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(1S,2R,10R,11R,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(1S,2R,10R,11R,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone |
|---|---|
| PubChem CID | 126185106 |
| Molecular Formula | C33H35N3O3 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(1S,2R,10R,11R,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-5-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C33H35N3O3/c37-33(36-14-12-35(13-15-36)19-21-6-11-28-29(16-21)39-20-38-28)25-9-10-27-26(18-25)30-23-7-8-24(17-23)31(30)32(34-27)22-4-2-1-3-5-22/h1-6,9-11,16,18,23-24,30-32,34H,7-8,12-15,17,19-20H2/t23-,24-,30-,31+,32-/m0/s1 |
| InChIKey | NQRGFOMGSRWNNI-ALPSWWAKSA-N |
| XLogP | 5.67 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |