C28H36N2O — CID 126183789
(1S,2R,10R,11R,12S)-N-(2,4-dimethylpentan-3-yl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126183789) has the molecular formula C28H36N2O and a molecular weight of 416.61 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-(2,4-dimethylpentan-3-yl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-(2,4-dimethylpentan-3-yl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126183789 |
| Molecular Formula | C28H36N2O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-(2,4-dimethylpentan-3-yl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2)C(C)C |
| InChI | InChI=1S/C28H36N2O/c1-16(2)26(17(3)4)30-28(31)21-12-13-23-22(15-21)24-19-10-11-20(14-19)25(24)27(29-23)18-8-6-5-7-9-18/h5-9,12-13,15-17,19-20,24-27,29H,10-11,14H2,1-4H3,(H,30,31)/t19-,20-,24-,25+,27-/m0/s1 |
| InChIKey | BOBZZDYJQLIVBS-PGJDGTSESA-N |
| XLogP | 6.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |