C26H32N2O — CID 126270354
(1S,2R,10S,11S,12S)-N-[(2S)-pentan-2-yl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126270354) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is (1S,2R,10S,11S,12S)-N-[(2S)-pentan-2-yl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10S,11S,12S)-N-[(2S)-pentan-2-yl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126270354 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (1S,2R,10S,11S,12S)-N-[(2S)-pentan-2-yl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | CCC[C@H](C)NC(=O)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]1[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C26H32N2O/c1-3-7-16(2)27-26(29)20-12-13-22-21(15-20)23-18-10-11-19(14-18)24(23)25(28-22)17-8-5-4-6-9-17/h4-6,8-9,12-13,15-16,18-19,23-25,28H,3,7,10-11,14H2,1-2H3,(H,27,29)/t16-,18-,19-,23-,24-,25+/m0/s1 |
| InChIKey | PPDNWUHSPMULEG-MGWUTECQSA-N |
| XLogP | 5.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |