C28H28N2OS — CID 126278187
(1S,2R,10R,11R,12S)-N-(2-methylsulfanylphenyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126278187) has the molecular formula C28H28N2OS and a molecular weight of 440.61 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-(2-methylsulfanylphenyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-(2-methylsulfanylphenyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126278187 |
| Molecular Formula | C28H28N2OS |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-(2-methylsulfanylphenyl)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | CSc1ccccc1NC(=O)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C28H28N2OS/c1-32-24-10-6-5-9-23(24)30-28(31)20-13-14-22-21(16-20)25-18-11-12-19(15-18)26(25)27(29-22)17-7-3-2-4-8-17/h2-10,13-14,16,18-19,25-27,29H,11-12,15H2,1H3,(H,30,31)/t18-,19-,25-,26+,27-/m0/s1 |
| InChIKey | XTBWPDGQFUSPSC-ZYAQVELZSA-N |
| XLogP | 6.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |