C36H35N3O2 — CID 126185207
(1S,2R,10S,11R,12S)-10-phenyl-N-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126185207) has the molecular formula C36H35N3O2 and a molecular weight of 541.70 g/mol. Its IUPAC name is (1S,2R,10S,11R,12S)-10-phenyl-N-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10S,11R,12S)-10-phenyl-N-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126185207 |
| Molecular Formula | C36H35N3O2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | (1S,2R,10S,11R,12S)-10-phenyl-N-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@@H](c1ccccc1)N2)c1ccccc1 |
| InChI | InChI=1S/C36H35N3O2/c1-22(23-10-4-2-5-11-23)37-36(41)28-14-8-9-15-30(28)39-35(40)27-18-19-31-29(21-27)32-25-16-17-26(20-25)33(32)34(38-31)24-12-6-3-7-13-24/h2-15,18-19,21-22,25-26,32-34,38H,16-17,20H2,1H3,(H,37,41)(H,39,40)/t22-,25-,26-,32-,33+,34+/m0/s1 |
| InChIKey | KUZRDXUOUFKVJW-NTCBMOERSA-N |
| XLogP | 7.73 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |