C29H34N2O3 — CID 124540105
ethyl 1-[(1S,2R,10R,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carbonyl]piperidine-4-carboxylate (PubChem CID 124540105) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl 1-[(1S,2R,10R,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(1S,2R,10R,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 124540105 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | ethyl 1-[(1S,2R,10R,11S,12S)-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc3c(c2)[C@@H]2[C@H]4CC[C@@H](C4)[C@@H]2[C@H](c2ccccc2)N3)CC1 |
| InChI | InChI=1S/C29H34N2O3/c1-2-34-29(33)19-12-14-31(15-13-19)28(32)22-10-11-24-23(17-22)25-20-8-9-21(16-20)26(25)27(30-24)18-6-4-3-5-7-18/h3-7,10-11,17,19-21,25-27,30H,2,8-9,12-16H2,1H3/t20-,21-,25-,26-,27-/m0/s1 |
| InChIKey | BNPNYKOOZUDQGR-UVSMYHIZSA-N |
| XLogP | 5.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |