C24H27NO2 — CID 124776307
(3aR,5S,7aR)-2-(2,6-diethylphenyl)-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 124776307) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (3aR,5S,7aR)-2-(2,6-diethylphenyl)-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,5S,7aR)-2-(2,6-diethylphenyl)-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124776307 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (3aR,5S,7aR)-2-(2,6-diethylphenyl)-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CCc1cccc(CC)c1N1C(=O)[C@@H]2CC[C@H](c3ccccc3)C[C@H]2C1=O |
| InChI | InChI=1S/C24H27NO2/c1-3-16-11-8-12-17(4-2)22(16)25-23(26)20-14-13-19(15-21(20)24(25)27)18-9-6-5-7-10-18/h5-12,19-21H,3-4,13-15H2,1-2H3/t19-,20+,21+/m0/s1 |
| InChIKey | TXLNPMJVWKULQQ-PWRODBHTSA-N |
| XLogP | 4.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|