About 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine
4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine (PubChem CID 124776966) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine |
| PubChem CID | 124776966 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine |
| SMILES | COc1cc(CN2C[C@@H](N3CCOCC3)[C@@H](C)C2)cc(OC)c1 |
| InChI | InChI=1S/C18H28N2O3/c1-14-11-19(13-18(14)20-4-6-23-7-5-20)12-15-8-16(21-2)10-17(9-15)22-3/h8-10,14,18H,4-7,11-13H2,1-3H3/t14-,18+/m0/s1 |
| InChIKey | JUMZELKSQGQWRT-KBXCAEBGSA-N |
| XLogP | 1.86 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine?
The IUPAC name of 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine (CID 124776966) is 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine.
What is the SMILES notation for 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine?
The canonical SMILES for 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine is COc1cc(CN2C[C@@H](N3CCOCC3)[C@@H](C)C2)cc(OC)c1.
What is the InChIKey of 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine?
The InChIKey is JUMZELKSQGQWRT-KBXCAEBGSA-N. The full InChI is InChI=1S/C18H28N2O3/c1-14-11-19(13-18(14)20-4-6-23-7-5-20)12-15-8-16(21-2)10-17(9-15)22-3/h8-10,14,18H,4-7,11-13H2,1-3H3/t14-,18+/m0/s1.
What are the key properties of 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine?
4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine has a molecular weight of 320.43 g/mol, XLogP of 1.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4S)-1-[(3,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]morpholine is sourced from PubChem (CID 124776966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).