C18H20OS — CID 124779593
(1S,3S,4R,6R,8S)-4-[(S)-phenylsulfinyl]tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene (PubChem CID 124779593) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is (1S,3S,4R,6R,8S)-4-[(S)-phenylsulfinyl]tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene.
| Compound Name | (1S,3S,4R,6R,8S)-4-[(S)-phenylsulfinyl]tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene |
|---|---|
| PubChem CID | 124779593 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (1S,3S,4R,6R,8S)-4-[(S)-phenylsulfinyl]tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene |
| SMILES | O=[S@](c1ccccc1)[C@@H]1C[C@H]2C[C@H]1C1=C2[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C18H20OS/c19-20(14-4-2-1-3-5-14)16-10-13-9-15(16)18-12-7-6-11(8-12)17(13)18/h1-5,11-13,15-16H,6-10H2/t11-,12-,13+,15+,16+,20+/m0/s1 |
| InChIKey | OITBQIGRFXNGRO-RLRURZOPSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|