C21H19F2NO2 — CID 124780002
(1S,2R,10S,11R,12S)-10-(2,5-difluorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid (PubChem CID 124780002) has the molecular formula C21H19F2NO2 and a molecular weight of 355.38 g/mol. Its IUPAC name is (1S,2R,10S,11R,12S)-10-(2,5-difluorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid.
| Compound Name | (1S,2R,10S,11R,12S)-10-(2,5-difluorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid |
|---|---|
| PubChem CID | 124780002 |
| Molecular Formula | C21H19F2NO2 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (1S,2R,10S,11R,12S)-10-(2,5-difluorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1N[C@H](c1cc(F)ccc1F)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]21 |
| InChI | InChI=1S/C21H19F2NO2/c22-12-6-7-16(23)15(9-12)20-18-11-5-4-10(8-11)17(18)13-2-1-3-14(21(25)26)19(13)24-20/h1-3,6-7,9-11,17-18,20,24H,4-5,8H2,(H,25,26)/t10-,11-,17-,18+,20+/m0/s1 |
| InChIKey | CHVWEFCXKUCBPM-ZCUMGQRUSA-N |
| XLogP | 4.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |