C21H20N2O4 — CID 126006218
(1S,2R,10S,11R,12S)-10-(2-nitrophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid (PubChem CID 126006218) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (1S,2R,10S,11R,12S)-10-(2-nitrophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid.
| Compound Name | (1S,2R,10S,11R,12S)-10-(2-nitrophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid |
|---|---|
| PubChem CID | 126006218 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (1S,2R,10S,11R,12S)-10-(2-nitrophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1N[C@H](c1ccccc1[N+](=O)[O-])[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]21 |
| InChI | InChI=1S/C21H20N2O4/c24-21(25)15-6-3-5-14-17-11-8-9-12(10-11)18(17)20(22-19(14)15)13-4-1-2-7-16(13)23(26)27/h1-7,11-12,17-18,20,22H,8-10H2,(H,24,25)/t11-,12-,17-,18+,20+/m0/s1 |
| InChIKey | RMSRNYLKCTVUFC-JEOQOABZSA-N |
| XLogP | 4.59 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|