C16H17FN4O2S — CID 124780372
N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide (PubChem CID 124780372) has the molecular formula C16H17FN4O2S and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 124780372 |
| Molecular Formula | C16H17FN4O2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NC[C@@H]1CO[C@@H]2CN(c3ncc(F)cn3)C[C@H]12)c1ccsc1 |
| InChI | InChI=1S/C16H17FN4O2S/c17-12-4-19-16(20-5-12)21-6-13-11(8-23-14(13)7-21)3-18-15(22)10-1-2-24-9-10/h1-2,4-5,9,11,13-14H,3,6-8H2,(H,18,22)/t11-,13-,14-/m1/s1 |
| InChIKey | IVFBXXILJCVTJF-MRVWCRGKSA-N |
| XLogP | 1.56 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |