C16H17FN4O2S — CID 97474227
N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]thiophene-3-carboxamide (PubChem CID 97474227) has the molecular formula C16H17FN4O2S and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 97474227 |
| Molecular Formula | C16H17FN4O2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NC[C@]12COC[C@H]1CN(c1ncc(F)cn1)C2)c1ccsc1 |
| InChI | InChI=1S/C16H17FN4O2S/c17-13-3-18-15(19-4-13)21-5-12-6-23-10-16(12,9-21)8-20-14(22)11-1-2-24-7-11/h1-4,7,12H,5-6,8-10H2,(H,20,22)/t12-,16+/m1/s1 |
| InChIKey | IRGPEZQJBINNQT-WBMJQRKESA-N |
| XLogP | 1.56 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |