C20H20N4O3 — CID 124780833
2-(4-nitroindol-1-yl)-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone (PubChem CID 124780833) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-(4-nitroindol-1-yl)-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone.
| Compound Name | 2-(4-nitroindol-1-yl)-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124780833 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(4-nitroindol-1-yl)-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone |
| SMILES | O=C(Cn1ccc2c([N+](=O)[O-])cccc21)N1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C20H20N4O3/c25-20(23-11-2-1-6-17(23)15-5-4-10-21-13-15)14-22-12-9-16-18(22)7-3-8-19(16)24(26)27/h3-5,7-10,12-13,17H,1-2,6,11,14H2/t17-/m1/s1 |
| InChIKey | UEZBVSRCIWQLBS-QGZVFWFLSA-N |
| XLogP | 3.70 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|