C19H23FN2O2S — CID 124781740
(4aS,7S,7aR)-4-[(4-fluorophenyl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 124781740) has the molecular formula C19H23FN2O2S and a molecular weight of 362.47 g/mol. Its IUPAC name is (4aS,7S,7aR)-4-[(4-fluorophenyl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7S,7aR)-4-[(4-fluorophenyl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124781740 |
| Molecular Formula | C19H23FN2O2S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (4aS,7S,7aR)-4-[(4-fluorophenyl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Fc1ccc(CN2CCO[C@@H]3[C@H](COCc4nccs4)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H23FN2O2S/c20-16-4-1-14(2-5-16)11-22-8-9-24-19-15(3-6-17(19)22)12-23-13-18-21-7-10-25-18/h1-2,4-5,7,10,15,17,19H,3,6,8-9,11-13H2/t15-,17-,19+/m0/s1 |
| InChIKey | AWQNHJVNHJVEJD-VDZJLULYSA-N |
| XLogP | 3.48 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |