C12H18N2O2S — CID 124790951
(4aR,7S,7aS)-7-(1,3-thiazol-2-ylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine (PubChem CID 124790951) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is (4aR,7S,7aS)-7-(1,3-thiazol-2-ylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7S,7aS)-7-(1,3-thiazol-2-ylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124790951 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (4aR,7S,7aS)-7-(1,3-thiazol-2-ylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
| SMILES | c1csc(COC[C@@H]2CC[C@H]3NCCO[C@@H]23)n1 |
| InChI | InChI=1S/C12H18N2O2S/c1-2-10-12(16-5-3-13-10)9(1)7-15-8-11-14-4-6-17-11/h4,6,9-10,12-13H,1-3,5,7-8H2/t9-,10+,12-/m0/s1 |
| InChIKey | KZPUTSPATLCNNS-UMNHJUIQSA-N |
| XLogP | 1.43 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |