C12H19ClN2O2S — CID 155853192
(4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride (PubChem CID 155853192) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride.
| Compound Name | (4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 155853192 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride |
| SMILES | Cc1nc(CO[C@@H]2CC[C@@H]3NCCO[C@H]32)cs1.Cl |
| InChI | InChI=1S/C12H18N2O2S.ClH/c1-8-14-9(7-17-8)6-16-11-3-2-10-12(11)15-5-4-13-10;/h7,10-13H,2-6H2,1H3;1H/t10-,11+,12+;/m0./s1 |
| InChIKey | SBTCALUORTYURC-YBWCDFGXSA-N |
| XLogP | 1.91 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |