C11H18N4O — CID 124912626
(4aS,7S,7aS)-7-[(5-methyltriazol-1-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine (PubChem CID 124912626) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (4aS,7S,7aS)-7-[(5-methyltriazol-1-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7S,7aS)-7-[(5-methyltriazol-1-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124912626 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (4aS,7S,7aS)-7-[(5-methyltriazol-1-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
| SMILES | Cc1cnnn1C[C@@H]1CC[C@@H]2NCCO[C@@H]12 |
| InChI | InChI=1S/C11H18N4O/c1-8-6-13-14-15(8)7-9-2-3-10-11(9)16-5-4-12-10/h6,9-12H,2-5,7H2,1H3/t9-,10-,11-/m0/s1 |
| InChIKey | ZRADXOJMYDWCPT-DCAQKATOSA-N |
| XLogP | 0.35 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |