C19H24F2N4 — CID 124781866
(7R)-5-[(3,4-difluorophenyl)methyl]-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine (PubChem CID 124781866) has the molecular formula C19H24F2N4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (7R)-5-[(3,4-difluorophenyl)methyl]-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine.
| Compound Name | (7R)-5-[(3,4-difluorophenyl)methyl]-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 124781866 |
| Molecular Formula | C19H24F2N4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (7R)-5-[(3,4-difluorophenyl)methyl]-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
| SMILES | Fc1ccc(CN2Cc3ccnn3C[C@H](CN3CCCC3)C2)cc1F |
| InChI | InChI=1S/C19H24F2N4/c20-18-4-3-15(9-19(18)21)10-24-12-16(11-23-7-1-2-8-23)13-25-17(14-24)5-6-22-25/h3-6,9,16H,1-2,7-8,10-14H2/t16-/m1/s1 |
| InChIKey | BUQYYXPBHYYRCH-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |