C19H26N4O2S — CID 124782236
N-[[(7R)-5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]thiophene-3-carboxamide (PubChem CID 124782236) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[[(7R)-5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[(7R)-5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 124782236 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[[(7R)-5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NC[C@@H]1CN(CC2CCOCC2)Cc2ccnn2C1)c1ccsc1 |
| InChI | InChI=1S/C19H26N4O2S/c24-19(17-4-8-26-14-17)20-9-16-11-22(10-15-2-6-25-7-3-15)13-18-1-5-21-23(18)12-16/h1,4-5,8,14-16H,2-3,6-7,9-13H2,(H,20,24)/t16-/m1/s1 |
| InChIKey | QEFFCOUTEQOHSV-MRXNPFEDSA-N |
| XLogP | 2.23 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |