C19H26N6O2 — CID 131671990
N-[[5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]pyridazine-4-carboxamide (PubChem CID 131671990) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[[5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 131671990 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-[[5-(oxan-4-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NCC1CN(CC2CCOCC2)Cc2ccnn2C1)c1ccnnc1 |
| InChI | InChI=1S/C19H26N6O2/c26-19(17-1-5-21-22-10-17)20-9-16-12-24(11-15-3-7-27-8-4-15)14-18-2-6-23-25(18)13-16/h1-2,5-6,10,15-16H,3-4,7-9,11-14H2,(H,20,26) |
| InChIKey | QGKXENNGVMSFLW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |