C15H19FN4O3 — CID 124786058
[(3aS,7aS)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 124786058) has the molecular formula C15H19FN4O3 and a molecular weight of 322.34 g/mol. Its IUPAC name is [(3aS,7aS)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3aS,7aS)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 124786058 |
| Molecular Formula | C15H19FN4O3 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(3aS,7aS)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C(N1CCCO1)[C@]12CCO[C@H]1CCN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C15H19FN4O3/c16-11-8-17-14(18-9-11)19-5-2-12-15(10-19,3-7-22-12)13(21)20-4-1-6-23-20/h8-9,12H,1-7,10H2/t12-,15-/m0/s1 |
| InChIKey | PEBQFMGQXNDNBB-WFASDCNBSA-N |
| XLogP | 0.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |