C13H17NO3S — CID 124788976
[(3R,3aR,7aS)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone (PubChem CID 124788976) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is [(3R,3aR,7aS)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3R,3aR,7aS)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 124788976 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [(3R,3aR,7aS)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone |
| SMILES | CO[C@@H]1CN(C(=O)c2cccs2)[C@H]2CCCO[C@@H]12 |
| InChI | InChI=1S/C13H17NO3S/c1-16-10-8-14(9-4-2-6-17-12(9)10)13(15)11-5-3-7-18-11/h3,5,7,9-10,12H,2,4,6,8H2,1H3/t9-,10+,12+/m0/s1 |
| InChIKey | GFFOYKJEPFMEAK-HOSYDEDBSA-N |
| XLogP | 1.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |