C19H24N4O4 — CID 124789770
N-[[(7R)-5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide (PubChem CID 124789770) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[[(7R)-5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide.
| Compound Name | N-[[(7R)-5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 124789770 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[[(7R)-5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC[C@@H]1CN(Cc2ccc3c(c2)OCO3)Cc2ccnn2C1 |
| InChI | InChI=1S/C19H24N4O4/c1-25-12-19(24)20-7-15-9-22(11-16-4-5-21-23(16)10-15)8-14-2-3-17-18(6-14)27-13-26-17/h2-6,15H,7-13H2,1H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | JSALUIGMWSLONH-OAHLLOKOSA-N |
| XLogP | 1.01 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |