C21H25F3N4O6 — CID 155834115
N-[[5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155834115) has the molecular formula C21H25F3N4O6 and a molecular weight of 486.45 g/mol. Its IUPAC name is N-[[5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834115 |
| Molecular Formula | C21H25F3N4O6 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[[5-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methyl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)NCC1CN(Cc2ccc3c(c2)OCO3)Cc2ccnn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N4O4.C2HF3O2/c1-25-12-19(24)20-7-15-9-22(11-16-4-5-21-23(16)10-15)8-14-2-3-17-18(6-14)27-13-26-17;3-2(4,5)1(6)7/h2-6,15H,7-13H2,1H3,(H,20,24);(H,6,7) |
| InChIKey | OVBFVUOMXWQSMC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |