C27H18F3N3O3 — CID 124789962
(1R,11S,12R,16R)-11-benzoyl-14-[2-(trifluoromethyl)phenyl]-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 124789962) has the molecular formula C27H18F3N3O3 and a molecular weight of 489.45 g/mol. Its IUPAC name is (1R,11S,12R,16R)-11-benzoyl-14-[2-(trifluoromethyl)phenyl]-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16R)-11-benzoyl-14-[2-(trifluoromethyl)phenyl]-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 124789962 |
| Molecular Formula | C27H18F3N3O3 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | (1R,11S,12R,16R)-11-benzoyl-14-[2-(trifluoromethyl)phenyl]-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H]2C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@H]2[C@@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C27H18F3N3O3/c28-27(29,30)18-12-6-7-13-19(18)32-25(35)20-21(26(32)36)23(24(34)15-8-2-1-3-9-15)33-22(20)17-11-5-4-10-16(17)14-31-33/h1-14,20-23H/t20-,21-,22+,23+/m1/s1 |
| InChIKey | KHONFLZAOMSTQJ-LUKWVAJMSA-N |
| XLogP | 4.47 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|