C17H23N3OS — CID 124790492
(7S)-7-[2-(cyclopropylmethoxy)ethyl]-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 124790492) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is (7S)-7-[2-(cyclopropylmethoxy)ethyl]-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | (7S)-7-[2-(cyclopropylmethoxy)ethyl]-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 124790492 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (7S)-7-[2-(cyclopropylmethoxy)ethyl]-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | c1csc(CN2Cc3ccnn3[C@@H](CCOCC3CC3)C2)c1 |
| InChI | InChI=1S/C17H23N3OS/c1-2-17(22-9-1)12-19-10-15-5-7-18-20(15)16(11-19)6-8-21-13-14-3-4-14/h1-2,5,7,9,14,16H,3-4,6,8,10-13H2/t16-/m0/s1 |
| InChIKey | NJEZZIDPDRYRFS-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|