C16H28N4O4S — CID 124805248
(7S)-N,N-dimethyl-7-[2-(oxan-4-ylmethoxy)ethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-sulfonamide (PubChem CID 124805248) has the molecular formula C16H28N4O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is (7S)-N,N-dimethyl-7-[2-(oxan-4-ylmethoxy)ethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-sulfonamide.
| Compound Name | (7S)-N,N-dimethyl-7-[2-(oxan-4-ylmethoxy)ethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-sulfonamide |
|---|---|
| PubChem CID | 124805248 |
| Molecular Formula | C16H28N4O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (7S)-N,N-dimethyl-7-[2-(oxan-4-ylmethoxy)ethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1Cc2ccnn2[C@@H](CCOCC2CCOCC2)C1 |
| InChI | InChI=1S/C16H28N4O4S/c1-18(2)25(21,22)19-11-15-3-7-17-20(15)16(12-19)6-10-24-13-14-4-8-23-9-5-14/h3,7,14,16H,4-6,8-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | YYPAXDXZPHGGOW-INIZCTEOSA-N |
| XLogP | 0.88 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|