C18H21NO3 — CID 124790949
[(3R,4R)-3-benzyl-4-methoxypiperidin-1-yl]-(furan-2-yl)methanone (PubChem CID 124790949) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [(3R,4R)-3-benzyl-4-methoxypiperidin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [(3R,4R)-3-benzyl-4-methoxypiperidin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 124790949 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [(3R,4R)-3-benzyl-4-methoxypiperidin-1-yl]-(furan-2-yl)methanone |
| SMILES | CO[C@@H]1CCN(C(=O)c2ccco2)C[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-21-16-9-10-19(18(20)17-8-5-11-22-17)13-15(16)12-14-6-3-2-4-7-14/h2-8,11,15-16H,9-10,12-13H2,1H3/t15-,16-/m1/s1 |
| InChIKey | NZLCGYMRIZFZDL-HZPDHXFCSA-N |
| XLogP | 3.00 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |